C26H29N5O2S2 — CID 4029344
2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 4029344) has the molecular formula C26H29N5O2S2 and a molecular weight of 507.69 g/mol. Its IUPAC name is 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4029344 |
| Molecular Formula | C26H29N5O2S2 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(CSc2nnc(Cc3ccccc3)n2-c2ccccc2OC)n1 |
| InChI | InChI=1S/C26H29N5O2S2/c1-3-4-10-15-27-25(32)20-17-34-24(28-20)18-35-26-30-29-23(16-19-11-6-5-7-12-19)31(26)21-13-8-9-14-22(21)33-2/h5-9,11-14,17H,3-4,10,15-16,18H2,1-2H3,(H,27,32) |
| InChIKey | IYUYONILLPKXNE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|