C25H27N5O2S2 — CID 3528890
2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-butyl-1,3-thiazole-4-carboxamide (PubChem CID 3528890) has the molecular formula C25H27N5O2S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-butyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-butyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3528890 |
| Molecular Formula | C25H27N5O2S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[[5-benzyl-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-butyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(CSc2nnc(Cc3ccccc3)n2-c2ccccc2OC)n1 |
| InChI | InChI=1S/C25H27N5O2S2/c1-3-4-14-26-24(31)19-16-33-23(27-19)17-34-25-29-28-22(15-18-10-6-5-7-11-18)30(25)20-12-8-9-13-21(20)32-2/h5-13,16H,3-4,14-15,17H2,1-2H3,(H,26,31) |
| InChIKey | FBFWUAXNFBZGDC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|