C28H37N5OS — CID 42741923
4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide (PubChem CID 42741923) has the molecular formula C28H37N5OS and a molecular weight of 491.71 g/mol. Its IUPAC name is 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide.
| Compound Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 42741923 |
| Molecular Formula | C28H37N5OS |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
| SMILES | CC1CCCCN1CCCNC(=O)CCCSc1nnc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C28H37N5OS/c1-23-12-8-9-19-32(23)20-11-18-29-27(34)17-10-21-35-28-31-30-26(22-24-13-4-2-5-14-24)33(28)25-15-6-3-7-16-25/h2-7,13-16,23H,8-12,17-22H2,1H3,(H,29,34) |
| InChIKey | DCKKDNDUIZZUQO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|