C27H26N4O2S — CID 51492550
N-(2-acetylphenyl)-4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 51492550) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-(2-acetylphenyl)-4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 51492550 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-(2-acetylphenyl)-4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CCCSc1nnc(Cc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26N4O2S/c1-20(32)23-15-8-9-16-24(23)28-26(33)17-10-18-34-27-30-29-25(19-21-11-4-2-5-12-21)31(27)22-13-6-3-7-14-22/h2-9,11-16H,10,17-19H2,1H3,(H,28,33) |
| InChIKey | VLYZLFCBTGIQQV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|