C28H26F3N3O2S — CID 4214188
N-benzyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide (PubChem CID 4214188) has the molecular formula C28H26F3N3O2S and a molecular weight of 525.60 g/mol. Its IUPAC name is N-benzyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-benzyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 4214188 |
| Molecular Formula | C28H26F3N3O2S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-benzyl-6-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanylhexanamide |
| SMILES | O=C(CCCCCSc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1)NCc1ccccc1 |
| InChI | InChI=1S/C28H26F3N3O2S/c29-28(30,31)21-12-9-13-22(18-21)34-26(36)23-14-6-7-15-24(23)33-27(34)37-17-8-2-5-16-25(35)32-19-20-10-3-1-4-11-20/h1,3-4,6-7,9-15,18H,2,5,8,16-17,19H2,(H,32,35) |
| InChIKey | FOAQDIIUYDMQFS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|