C33H30FN3O2S — CID 42744042
N-benzhydryl-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide (PubChem CID 42744042) has the molecular formula C33H30FN3O2S and a molecular weight of 551.69 g/mol. Its IUPAC name is N-benzhydryl-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-benzhydryl-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 42744042 |
| Molecular Formula | C33H30FN3O2S |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-benzhydryl-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
| SMILES | O=C(CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30FN3O2S/c34-26-19-21-27(22-20-26)37-32(39)28-16-9-10-17-29(28)35-33(37)40-23-11-3-8-18-30(38)36-31(24-12-4-1-5-13-24)25-14-6-2-7-15-25/h1-2,4-7,9-10,12-17,19-22,31H,3,8,11,18,23H2,(H,36,38) |
| InChIKey | GYFXUFJHRNJIRK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|