C25H20FN3O3S — CID 137118905
N-benzhydryl-2-[1-(4-fluorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 137118905) has the molecular formula C25H20FN3O3S and a molecular weight of 461.52 g/mol. Its IUPAC name is N-benzhydryl-2-[1-(4-fluorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[1-(4-fluorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 137118905 |
| Molecular Formula | C25H20FN3O3S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-benzhydryl-2-[1-(4-fluorophenyl)-4-hydroxy-6-oxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc(O)cc(=O)n1-c1ccc(F)cc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20FN3O3S/c26-19-11-13-20(14-12-19)29-23(32)15-21(30)28-25(29)33-16-22(31)27-24(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15,24,30H,16H2,(H,27,31) |
| InChIKey | HVWISBOLHZHVKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |