C29H26F3N5O4S — CID 42735232
2-[1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 42735232) has the molecular formula C29H26F3N5O4S and a molecular weight of 597.62 g/mol. Its IUPAC name is 2-[1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 2-[1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42735232 |
| Molecular Formula | C29H26F3N5O4S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]sulfanyl-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCC(Sc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1)C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H26F3N5O4S/c1-2-25(27(39)35-16-14-34(15-17-35)20-10-12-21(13-11-20)37(40)41)42-28-33-24-9-4-3-8-23(24)26(38)36(28)22-7-5-6-19(18-22)29(30,31)32/h3-13,18,25H,2,14-17H2,1H3 |
| InChIKey | OAOGRAQYGLKYKF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|