C34H31Cl2N3OS — CID 3569556
N-[2-(2,4-dichlorophenyl)ethyl]-5-(1,4,5-triphenylimidazol-2-yl)sulfanylpentanamide (PubChem CID 3569556) has the molecular formula C34H31Cl2N3OS and a molecular weight of 600.62 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-(1,4,5-triphenylimidazol-2-yl)sulfanylpentanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-(1,4,5-triphenylimidazol-2-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 3569556 |
| Molecular Formula | C34H31Cl2N3OS |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-(1,4,5-triphenylimidazol-2-yl)sulfanylpentanamide |
| SMILES | O=C(CCCCSc1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H31Cl2N3OS/c35-28-20-19-25(30(36)24-28)21-22-37-31(40)18-10-11-23-41-34-38-32(26-12-4-1-5-13-26)33(27-14-6-2-7-15-27)39(34)29-16-8-3-9-17-29/h1-9,12-17,19-20,24H,10-11,18,21-23H2,(H,37,40) |
| InChIKey | RBRAKCQQWJSRCB-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|