C35H35N3OS — CID 42657918
4-tert-butyl-N-[3-(1,4,5-triphenylimidazol-2-yl)sulfanylpropyl]benzamide (PubChem CID 42657918) has the molecular formula C35H35N3OS and a molecular weight of 545.75 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(1,4,5-triphenylimidazol-2-yl)sulfanylpropyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-(1,4,5-triphenylimidazol-2-yl)sulfanylpropyl]benzamide |
|---|---|
| PubChem CID | 42657918 |
| Molecular Formula | C35H35N3OS |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 4-tert-butyl-N-[3-(1,4,5-triphenylimidazol-2-yl)sulfanylpropyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCCSc2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H35N3OS/c1-35(2,3)29-22-20-28(21-23-29)33(39)36-24-13-25-40-34-37-31(26-14-7-4-8-15-26)32(27-16-9-5-10-17-27)38(34)30-18-11-6-12-19-30/h4-12,14-23H,13,24-25H2,1-3H3,(H,36,39) |
| InChIKey | CINJAEQSGUIKAX-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|