C30H33N3OS — CID 42725819
4-ethyl-N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]benzamide (PubChem CID 42725819) has the molecular formula C30H33N3OS and a molecular weight of 483.68 g/mol. Its IUPAC name is 4-ethyl-N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]benzamide.
| Compound Name | 4-ethyl-N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]benzamide |
|---|---|
| PubChem CID | 42725819 |
| Molecular Formula | C30H33N3OS |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-ethyl-N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]benzamide |
| SMILES | CCc1ccc(C(=O)NCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)n2CC)cc1 |
| InChI | InChI=1S/C30H33N3OS/c1-3-23-17-19-26(20-18-23)29(34)31-21-11-12-22-35-30-32-27(24-13-7-5-8-14-24)28(33(30)4-2)25-15-9-6-10-16-25/h5-10,13-20H,3-4,11-12,21-22H2,1-2H3,(H,31,34) |
| InChIKey | KRWNPHGPDHGMKC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|