C32H37N3OS — CID 3693436
N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-2-phenylbutanamide (PubChem CID 3693436) has the molecular formula C32H37N3OS and a molecular weight of 511.74 g/mol. Its IUPAC name is N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-2-phenylbutanamide.
| Compound Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 3693436 |
| Molecular Formula | C32H37N3OS |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-2-phenylbutanamide |
| SMILES | CCCn1c(SCCCCNC(=O)C(CC)c2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H37N3OS/c1-3-23-35-30(27-20-12-7-13-21-27)29(26-18-10-6-11-19-26)34-32(35)37-24-15-14-22-33-31(36)28(4-2)25-16-8-5-9-17-25/h5-13,16-21,28H,3-4,14-15,22-24H2,1-2H3,(H,33,36) |
| InChIKey | YISMKYLNMQGIMZ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|