C26H33N3OS — CID 4238393
N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-methylbutanamide (PubChem CID 4238393) has the molecular formula C26H33N3OS and a molecular weight of 435.64 g/mol. Its IUPAC name is N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-methylbutanamide.
| Compound Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4238393 |
| Molecular Formula | C26H33N3OS |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-methylbutanamide |
| SMILES | CCCn1c(SCCCNC(=O)CC(C)C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H33N3OS/c1-4-17-29-25(22-14-9-6-10-15-22)24(21-12-7-5-8-13-21)28-26(29)31-18-11-16-27-23(30)19-20(2)3/h5-10,12-15,20H,4,11,16-19H2,1-3H3,(H,27,30) |
| InChIKey | IQELXAWAXWCQMX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|