C29H37N3OS — CID 4598750
N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]cyclohexanecarboxamide (PubChem CID 4598750) has the molecular formula C29H37N3OS and a molecular weight of 475.70 g/mol. Its IUPAC name is N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4598750 |
| Molecular Formula | C29H37N3OS |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]cyclohexanecarboxamide |
| SMILES | CCCn1c(SCCCCNC(=O)C2CCCCC2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H37N3OS/c1-2-21-32-27(24-16-8-4-9-17-24)26(23-14-6-3-7-15-23)31-29(32)34-22-13-12-20-30-28(33)25-18-10-5-11-19-25/h3-4,6-9,14-17,25H,2,5,10-13,18-22H2,1H3,(H,30,33) |
| InChIKey | FBMNYIGVOPEFIF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|