C30H41N3O3S — CID 3280619
5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-pentylpentanamide (PubChem CID 3280619) has the molecular formula C30H41N3O3S and a molecular weight of 523.74 g/mol. Its IUPAC name is 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-pentylpentanamide.
| Compound Name | 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-pentylpentanamide |
|---|---|
| PubChem CID | 3280619 |
| Molecular Formula | C30H41N3O3S |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 5-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanyl-N-pentylpentanamide |
| SMILES | CCCCCNC(=O)CCCCSc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)n1CCC |
| InChI | InChI=1S/C30H41N3O3S/c1-5-7-9-20-31-27(34)11-8-10-22-37-30-32-28(23-12-16-25(35-3)17-13-23)29(33(30)21-6-2)24-14-18-26(36-4)19-15-24/h12-19H,5-11,20-22H2,1-4H3,(H,31,34) |
| InChIKey | ONUOQFCNOVFZSN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|