C30H31Cl2N3O3S — CID 3925766
N-[3-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylpropyl]-3,4-dichlorobenzamide (PubChem CID 3925766) has the molecular formula C30H31Cl2N3O3S and a molecular weight of 584.57 g/mol. Its IUPAC name is N-[3-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylpropyl]-3,4-dichlorobenzamide.
| Compound Name | N-[3-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylpropyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3925766 |
| Molecular Formula | C30H31Cl2N3O3S |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | N-[3-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylpropyl]-3,4-dichlorobenzamide |
| SMILES | CCCn1c(SCCCNC(=O)c2ccc(Cl)c(Cl)c2)nc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H31Cl2N3O3S/c1-4-17-35-28(21-8-13-24(38-3)14-9-21)27(20-6-11-23(37-2)12-7-20)34-30(35)39-18-5-16-33-29(36)22-10-15-25(31)26(32)19-22/h6-15,19H,4-5,16-18H2,1-3H3,(H,33,36) |
| InChIKey | DEMIRWIAEBPSTG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|