C28H28FN3OS — CID 5137693
N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-4-fluorobenzamide (PubChem CID 5137693) has the molecular formula C28H28FN3OS and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-4-fluorobenzamide.
| Compound Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 5137693 |
| Molecular Formula | C28H28FN3OS |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-4-fluorobenzamide |
| SMILES | CCCn1c(SCCCNC(=O)c2ccc(F)cc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H28FN3OS/c1-2-19-32-26(22-12-7-4-8-13-22)25(21-10-5-3-6-11-21)31-28(32)34-20-9-18-30-27(33)23-14-16-24(29)17-15-23/h3-8,10-17H,2,9,18-20H2,1H3,(H,30,33) |
| InChIKey | BJEXUDCVNKZFBA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|