C30H31N3OS — CID 4683494
N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-phenylprop-2-enamide (PubChem CID 4683494) has the molecular formula C30H31N3OS and a molecular weight of 481.67 g/mol. Its IUPAC name is N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4683494 |
| Molecular Formula | C30H31N3OS |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-3-phenylprop-2-enamide |
| SMILES | CCCn1c(SCCCNC(=O)C=Cc2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H31N3OS/c1-2-22-33-29(26-17-10-5-11-18-26)28(25-15-8-4-9-16-25)32-30(33)35-23-12-21-31-27(34)20-19-24-13-6-3-7-14-24/h3-11,13-20H,2,12,21-23H2,1H3,(H,31,34) |
| InChIKey | HTNLPCIZSFAZBN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|