C29H39N3OS — CID 3880800
N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-2-ethylhexanamide (PubChem CID 3880800) has the molecular formula C29H39N3OS and a molecular weight of 477.72 g/mol. Its IUPAC name is N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-2-ethylhexanamide.
| Compound Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 3880800 |
| Molecular Formula | C29H39N3OS |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N-[3-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylpropyl]-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NCCCSc1nc(-c2ccccc2)c(-c2ccccc2)n1CCC |
| InChI | InChI=1S/C29H39N3OS/c1-4-7-15-23(6-3)28(33)30-20-14-22-34-29-31-26(24-16-10-8-11-17-24)27(32(29)21-5-2)25-18-12-9-13-19-25/h8-13,16-19,23H,4-7,14-15,20-22H2,1-3H3,(H,30,33) |
| InChIKey | MRGHVINGMGUJMP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|