C34H41N3OS — CID 4534418
N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-4-pentylbenzamide (PubChem CID 4534418) has the molecular formula C34H41N3OS and a molecular weight of 539.79 g/mol. Its IUPAC name is N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-4-pentylbenzamide.
| Compound Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 4534418 |
| Molecular Formula | C34H41N3OS |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | N-[4-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylbutyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)n2CCC)cc1 |
| InChI | InChI=1S/C34H41N3OS/c1-3-5-8-15-27-20-22-30(23-21-27)33(38)35-24-13-14-26-39-34-36-31(28-16-9-6-10-17-28)32(37(34)25-4-2)29-18-11-7-12-19-29/h6-7,9-12,16-23H,3-5,8,13-15,24-26H2,1-2H3,(H,35,38) |
| InChIKey | BXGRZYWWTROMDS-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|