C33H39N3O3S — CID 4543196
N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-4-butylbenzamide (PubChem CID 4543196) has the molecular formula C33H39N3O3S and a molecular weight of 557.76 g/mol. Its IUPAC name is N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-4-butylbenzamide.
| Compound Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-4-butylbenzamide |
|---|---|
| PubChem CID | 4543196 |
| Molecular Formula | C33H39N3O3S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-4-butylbenzamide |
| SMILES | CCCCc1ccc(C(=O)NCCSc2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)n2CCC)cc1 |
| InChI | InChI=1S/C33H39N3O3S/c1-5-7-8-24-9-11-27(12-10-24)32(37)34-21-23-40-33-35-30(25-13-17-28(38-3)18-14-25)31(36(33)22-6-2)26-15-19-29(39-4)20-16-26/h9-20H,5-8,21-23H2,1-4H3,(H,34,37) |
| InChIKey | AXMJTKQYHGRODR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|