C30H39N3O3S — CID 3984603
N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-cyclopentylpropanamide (PubChem CID 3984603) has the molecular formula C30H39N3O3S and a molecular weight of 521.73 g/mol. Its IUPAC name is N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-cyclopentylpropanamide.
| Compound Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 3984603 |
| Molecular Formula | C30H39N3O3S |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-cyclopentylpropanamide |
| SMILES | CCCn1c(SCCNC(=O)CCC2CCCC2)nc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H39N3O3S/c1-4-20-33-29(24-12-16-26(36-3)17-13-24)28(23-10-14-25(35-2)15-11-23)32-30(33)37-21-19-31-27(34)18-9-22-7-5-6-8-22/h10-17,22H,4-9,18-21H2,1-3H3,(H,31,34) |
| InChIKey | ZHLJYRQSWYGKAN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|