C26H32N4O5S — CID 3921935
ethyl 2-[2-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]sulfanylethylcarbamoylamino]acetate (PubChem CID 3921935) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is ethyl 2-[2-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]sulfanylethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]sulfanylethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 3921935 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | ethyl 2-[2-[1-ethyl-4,5-bis(4-methoxyphenyl)imidazol-2-yl]sulfanylethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCSc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)n1CC |
| InChI | InChI=1S/C26H32N4O5S/c1-5-30-24(19-9-13-21(34-4)14-10-19)23(18-7-11-20(33-3)12-8-18)29-26(30)36-16-15-27-25(32)28-17-22(31)35-6-2/h7-14H,5-6,15-17H2,1-4H3,(H2,27,28,32) |
| InChIKey | SUOZNZOCOHAGHZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|