C31H36N4O5S — CID 42657911
1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 42657911) has the molecular formula C31H36N4O5S and a molecular weight of 576.72 g/mol. Its IUPAC name is 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 42657911 |
| Molecular Formula | C31H36N4O5S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | CCCn1c(SCCNC(=O)Nc2ccc(OC)cc2OC)nc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H36N4O5S/c1-6-18-35-29(22-9-13-24(38-3)14-10-22)28(21-7-11-23(37-2)12-8-21)34-31(35)41-19-17-32-30(36)33-26-16-15-25(39-4)20-27(26)40-5/h7-16,20H,6,17-19H2,1-5H3,(H2,32,33,36) |
| InChIKey | QDTIMEALAWOCDK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|