C29H31FN4O3S — CID 3375678
1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2-fluorophenyl)urea (PubChem CID 3375678) has the molecular formula C29H31FN4O3S and a molecular weight of 534.66 g/mol. Its IUPAC name is 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 3375678 |
| Molecular Formula | C29H31FN4O3S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[2-[4,5-bis(4-methoxyphenyl)-1-propylimidazol-2-yl]sulfanylethyl]-3-(2-fluorophenyl)urea |
| SMILES | CCCn1c(SCCNC(=O)Nc2ccccc2F)nc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H31FN4O3S/c1-4-18-34-27(21-11-15-23(37-3)16-12-21)26(20-9-13-22(36-2)14-10-20)33-29(34)38-19-17-31-28(35)32-25-8-6-5-7-24(25)30/h5-16H,4,17-19H2,1-3H3,(H2,31,32,35) |
| InChIKey | QMXGUVBFNPIRNA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|