C25H30ClN3OS — CID 3556679
3-chloro-N-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-2,2-dimethylpropanamide (PubChem CID 3556679) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is 3-chloro-N-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3556679 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-chloro-N-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]-2,2-dimethylpropanamide |
| SMILES | CCCn1c(SCCNC(=O)C(C)(C)CCl)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H30ClN3OS/c1-4-16-29-22(20-13-9-6-10-14-20)21(19-11-7-5-8-12-19)28-24(29)31-17-15-27-23(30)25(2,3)18-26/h5-14H,4,15-18H2,1-3H3,(H,27,30) |
| InChIKey | SCFRZKXIWYOAPA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|