C27H25F3N4OS — CID 4236781
1-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 4236781) has the molecular formula C27H25F3N4OS and a molecular weight of 510.59 g/mol. Its IUPAC name is 1-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 4236781 |
| Molecular Formula | C27H25F3N4OS |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 1-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCn1c(SCCNC(=O)Nc2ccccc2C(F)(F)F)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H25F3N4OS/c1-2-34-24(20-13-7-4-8-14-20)23(19-11-5-3-6-12-19)33-26(34)36-18-17-31-25(35)32-22-16-10-9-15-21(22)27(28,29)30/h3-16H,2,17-18H2,1H3,(H2,31,32,35) |
| InChIKey | BMTNNKSRRQRGRB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|