C26H27N3O3S2 — CID 4566754
N-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-methoxybenzenesulfonamide (PubChem CID 4566754) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 4566754 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[2-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-methoxybenzenesulfonamide |
| SMILES | CCn1c(SCCNS(=O)(=O)c2ccc(OC)cc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-3-29-25(21-12-8-5-9-13-21)24(20-10-6-4-7-11-20)28-26(29)33-19-18-27-34(30,31)23-16-14-22(32-2)15-17-23/h4-17,27H,3,18-19H2,1-2H3 |
| InChIKey | QWBFCXXBXMLCOJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|