C27H28N4O4S2 — CID 4566482
N-[2-(1-butyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-nitrobenzenesulfonamide (PubChem CID 4566482) has the molecular formula C27H28N4O4S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is N-[2-(1-butyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-(1-butyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4566482 |
| Molecular Formula | C27H28N4O4S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[2-(1-butyl-4,5-diphenylimidazol-2-yl)sulfanylethyl]-4-nitrobenzenesulfonamide |
| SMILES | CCCCn1c(SCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H28N4O4S2/c1-2-3-19-30-26(22-12-8-5-9-13-22)25(21-10-6-4-7-11-21)29-27(30)36-20-18-28-37(34,35)24-16-14-23(15-17-24)31(32)33/h4-17,28H,2-3,18-20H2,1H3 |
| InChIKey | XQRHPOFTKNYRIF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|