C30H29N3O2S2 — CID 42725796
N-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]naphthalene-2-sulfonamide (PubChem CID 42725796) has the molecular formula C30H29N3O2S2 and a molecular weight of 527.72 g/mol. Its IUPAC name is N-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42725796 |
| Molecular Formula | C30H29N3O2S2 |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]naphthalene-2-sulfonamide |
| SMILES | CCn1c(SCCCNS(=O)(=O)c2ccc3ccccc3c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H29N3O2S2/c1-2-33-29(25-15-7-4-8-16-25)28(24-13-5-3-6-14-24)32-30(33)36-21-11-20-31-37(34,35)27-19-18-23-12-9-10-17-26(23)22-27/h3-10,12-19,22,31H,2,11,20-21H2,1H3 |
| InChIKey | XTMFPJYMIMWVHD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|