C21H22N2O2S — CID 42725662
4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutanoic acid (PubChem CID 42725662) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutanoic acid.
| Compound Name | 4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 42725662 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutanoic acid |
| SMILES | CCn1c(SCCCC(=O)O)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-2-23-20(17-12-7-4-8-13-17)19(16-10-5-3-6-11-16)22-21(23)26-15-9-14-18(24)25/h3-8,10-13H,2,9,14-15H2,1H3,(H,24,25) |
| InChIKey | ODOWYEKVDRHAKI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|