C28H28N2O2 — CID 22916430
7-(2,4,5-triphenylimidazol-1-yl)heptanoic acid (PubChem CID 22916430) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 7-(2,4,5-triphenylimidazol-1-yl)heptanoic acid.
| Compound Name | 7-(2,4,5-triphenylimidazol-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 22916430 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 7-(2,4,5-triphenylimidazol-1-yl)heptanoic acid |
| SMILES | O=C(O)CCCCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c31-25(32)20-12-1-2-13-21-30-27(23-16-8-4-9-17-23)26(22-14-6-3-7-15-22)29-28(30)24-18-10-5-11-19-24/h3-11,14-19H,1-2,12-13,20-21H2,(H,31,32) |
| InChIKey | ZQFUJQZVCBPDPA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|