5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid

C22H25N3O2 — CID 18537524

IUPAC5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid
SMILESCc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCNC(=O)O
InChIInChI=1S/C22H25N3O2/c1-17-24-20(18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)25(17)16-10-4-9-15-23-22(26)27/h2-3,5-8,11-14,23H,4,9-10,15-16H2,1H3,(H,26,27)
InChIKeyKJLVZVJTXPPBDQ-UHFFFAOYSA-N
MW363.46 g/mol
LogP4.96
Rot. Bonds8

About 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid

5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid (PubChem CID 18537524) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid.

Molecular Properties

Compound Name5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid
PubChem CID18537524
Molecular FormulaC22H25N3O2
Molecular Weight363.46 g/mol
Exact Mass363.19
IUPAC Name5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid
SMILESCc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCNC(=O)O
InChIInChI=1S/C22H25N3O2/c1-17-24-20(18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)25(17)16-10-4-9-15-23-22(26)27/h2-3,5-8,11-14,23H,4,9-10,15-16H2,1H3,(H,26,27)
InChIKeyKJLVZVJTXPPBDQ-UHFFFAOYSA-N
XLogP4.96
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.46
LogP ≤ 54.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid?
The IUPAC name of 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid (CID 18537524) is 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid.
What is the SMILES notation for 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid?
The canonical SMILES for 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid is Cc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCNC(=O)O.
What is the InChIKey of 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid?
The InChIKey is KJLVZVJTXPPBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c1-17-24-20(18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)25(17)16-10-4-9-15-23-22(26)27/h2-3,5-8,11-14,23H,4,9-10,15-16H2,1H3,(H,26,27).
What are the key properties of 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid?
5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid has a molecular weight of 363.46 g/mol, XLogP of 4.96, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-4,5-diphenylimidazol-1-yl)pentylcarbamic acid is sourced from PubChem (CID 18537524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).