C25H30N2O2 — CID 59926126
ethyl 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate (PubChem CID 59926126) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is ethyl 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate.
| Compound Name | ethyl 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate |
|---|---|
| PubChem CID | 59926126 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | ethyl 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c1-3-29-23(28)18-12-4-5-13-19-27-20(2)26-24(21-14-8-6-9-15-21)25(27)22-16-10-7-11-17-22/h6-11,14-17H,3-5,12-13,18-19H2,1-2H3 |
| InChIKey | KADOCUYCTLJXRV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|