C45H57N7O6 — CID 71311005
ethyl 5-[2-[[bis[[1-(5-ethoxy-5-oxopentyl)benzimidazol-2-yl]methyl]amino]methyl]benzimidazol-1-yl]pentanoate (PubChem CID 71311005) has the molecular formula C45H57N7O6 and a molecular weight of 791.99 g/mol. Its IUPAC name is ethyl 5-[2-[[bis[[1-(5-ethoxy-5-oxopentyl)benzimidazol-2-yl]methyl]amino]methyl]benzimidazol-1-yl]pentanoate.
| Compound Name | ethyl 5-[2-[[bis[[1-(5-ethoxy-5-oxopentyl)benzimidazol-2-yl]methyl]amino]methyl]benzimidazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 71311005 |
| Molecular Formula | C45H57N7O6 |
| Molecular Weight | 791.99 g/mol |
| Exact Mass | 791.44 |
| IUPAC Name | ethyl 5-[2-[[bis[[1-(5-ethoxy-5-oxopentyl)benzimidazol-2-yl]methyl]amino]methyl]benzimidazol-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1c(CN(Cc2nc3ccccc3n2CCCCC(=O)OCC)Cc2nc3ccccc3n2CCCCC(=O)OCC)nc2ccccc21 |
| InChI | InChI=1S/C45H57N7O6/c1-4-56-43(53)25-13-16-28-50-37-22-10-7-19-34(37)46-40(50)31-49(32-41-47-35-20-8-11-23-38(35)51(41)29-17-14-26-44(54)57-5-2)33-42-48-36-21-9-12-24-39(36)52(42)30-18-15-27-45(55)58-6-3/h7-12,19-24H,4-6,13-18,25-33H2,1-3H3 |
| InChIKey | RWKPMARHPVSMQT-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 135.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.99 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|