C14H18N2O2S — CID 155778353
ethyl 4-(2-methylsulfanylbenzimidazol-1-yl)butanoate (PubChem CID 155778353) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is ethyl 4-(2-methylsulfanylbenzimidazol-1-yl)butanoate.
| Compound Name | ethyl 4-(2-methylsulfanylbenzimidazol-1-yl)butanoate |
|---|---|
| PubChem CID | 155778353 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl 4-(2-methylsulfanylbenzimidazol-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1c(SC)nc2ccccc21 |
| InChI | InChI=1S/C14H18N2O2S/c1-3-18-13(17)9-6-10-16-12-8-5-4-7-11(12)15-14(16)19-2/h4-5,7-8H,3,6,9-10H2,1-2H3 |
| InChIKey | ZXIKSZGKQOZOOQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |