C23H22N2O4 — CID 169196902
ethyl 4-[2-(7-methyl-2-oxochromen-3-yl)benzimidazol-1-yl]butanoate (PubChem CID 169196902) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 4-[2-(7-methyl-2-oxochromen-3-yl)benzimidazol-1-yl]butanoate.
| Compound Name | ethyl 4-[2-(7-methyl-2-oxochromen-3-yl)benzimidazol-1-yl]butanoate |
|---|---|
| PubChem CID | 169196902 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | ethyl 4-[2-(7-methyl-2-oxochromen-3-yl)benzimidazol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c(-c2cc3ccc(C)cc3oc2=O)nc2ccccc21 |
| InChI | InChI=1S/C23H22N2O4/c1-3-28-21(26)9-6-12-25-19-8-5-4-7-18(19)24-22(25)17-14-16-11-10-15(2)13-20(16)29-23(17)27/h4-5,7-8,10-11,13-14H,3,6,9,12H2,1-2H3 |
| InChIKey | JDELYXICMLCOCZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|