C30H36N2O2 — CID 66665662
ethyl 7-(2-methyl-6,7-diphenyl-3,4-dihydro-2H-1,8-naphthyridin-1-yl)heptanoate (PubChem CID 66665662) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is ethyl 7-(2-methyl-6,7-diphenyl-3,4-dihydro-2H-1,8-naphthyridin-1-yl)heptanoate.
| Compound Name | ethyl 7-(2-methyl-6,7-diphenyl-3,4-dihydro-2H-1,8-naphthyridin-1-yl)heptanoate |
|---|---|
| PubChem CID | 66665662 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | ethyl 7-(2-methyl-6,7-diphenyl-3,4-dihydro-2H-1,8-naphthyridin-1-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCCN1c2nc(-c3ccccc3)c(-c3ccccc3)cc2CCC1C |
| InChI | InChI=1S/C30H36N2O2/c1-3-34-28(33)18-12-4-5-13-21-32-23(2)19-20-26-22-27(24-14-8-6-9-15-24)29(31-30(26)32)25-16-10-7-11-17-25/h6-11,14-17,22-23H,3-5,12-13,18-21H2,1-2H3 |
| InChIKey | HNUAKWRQNAOCFZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|