C23H31NO4 — CID 20801282
ethyl 7-[2-oxo-5-[(E)-3-oxo-4-phenylbut-1-enyl]pyrrolidin-1-yl]heptanoate (PubChem CID 20801282) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is ethyl 7-[2-oxo-5-[(E)-3-oxo-4-phenylbut-1-enyl]pyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[2-oxo-5-[(E)-3-oxo-4-phenylbut-1-enyl]pyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 20801282 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | ethyl 7-[2-oxo-5-[(E)-3-oxo-4-phenylbut-1-enyl]pyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CCC1/C=C/C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO4/c1-2-28-23(27)12-8-3-4-9-17-24-20(14-16-22(24)26)13-15-21(25)18-19-10-6-5-7-11-19/h5-7,10-11,13,15,20H,2-4,8-9,12,14,16-18H2,1H3/b15-13+ |
| InChIKey | FRQUIBIIJSBKMF-FYWRMAATSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|