C22H29NO4S — CID 66791198
methyl 4-[2-[(6R)-2-oxo-6-[(E)-3-oxo-4-phenylbut-1-enyl]piperidin-1-yl]ethylsulfanyl]butanoate (PubChem CID 66791198) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is methyl 4-[2-[(6R)-2-oxo-6-[(E)-3-oxo-4-phenylbut-1-enyl]piperidin-1-yl]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-[2-[(6R)-2-oxo-6-[(E)-3-oxo-4-phenylbut-1-enyl]piperidin-1-yl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 66791198 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 4-[2-[(6R)-2-oxo-6-[(E)-3-oxo-4-phenylbut-1-enyl]piperidin-1-yl]ethylsulfanyl]butanoate |
| SMILES | COC(=O)CCCSCCN1C(=O)CCC[C@@H]1/C=C/C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO4S/c1-27-22(26)11-6-15-28-16-14-23-19(9-5-10-21(23)25)12-13-20(24)17-18-7-3-2-4-8-18/h2-4,7-8,12-13,19H,5-6,9-11,14-17H2,1H3/b13-12+/t19-/m1/s1 |
| InChIKey | XUQBDAGQDZXZAS-JXOMPUQVSA-N |
| XLogP | 3.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|