C20H27NO2S — CID 58770094
(6R)-6-[(E)-3-oxo-4-phenylbut-1-enyl]-1-(2-propylsulfanylethyl)piperidin-2-one (PubChem CID 58770094) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is (6R)-6-[(E)-3-oxo-4-phenylbut-1-enyl]-1-(2-propylsulfanylethyl)piperidin-2-one.
| Compound Name | (6R)-6-[(E)-3-oxo-4-phenylbut-1-enyl]-1-(2-propylsulfanylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 58770094 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (6R)-6-[(E)-3-oxo-4-phenylbut-1-enyl]-1-(2-propylsulfanylethyl)piperidin-2-one |
| SMILES | CCCSCCN1C(=O)CCC[C@@H]1/C=C/C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO2S/c1-2-14-24-15-13-21-18(9-6-10-20(21)23)11-12-19(22)16-17-7-4-3-5-8-17/h3-5,7-8,11-12,18H,2,6,9-10,13-16H2,1H3/b12-11+/t18-/m1/s1 |
| InChIKey | JYRZRMMYUQLKTQ-IENJSVCTSA-N |
| XLogP | 3.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|