C22H31NO3 — CID 149297303
7-[(6R)-2-oxo-6-[(E)-4-phenylbut-1-enyl]piperidin-1-yl]heptanoic acid (PubChem CID 149297303) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 7-[(6R)-2-oxo-6-[(E)-4-phenylbut-1-enyl]piperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(6R)-2-oxo-6-[(E)-4-phenylbut-1-enyl]piperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 149297303 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 7-[(6R)-2-oxo-6-[(E)-4-phenylbut-1-enyl]piperidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC[C@@H]1/C=C/CCc1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c24-21-16-10-15-20(14-8-7-13-19-11-4-3-5-12-19)23(21)18-9-2-1-6-17-22(25)26/h3-5,8,11-12,14,20H,1-2,6-7,9-10,13,15-18H2,(H,25,26)/b14-8+/t20-/m0/s1 |
| InChIKey | XWAVYIYWLMLNSP-MXECYCPESA-N |
| XLogP | 4.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|