About propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate
propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate (PubChem CID 123862098) has the molecular formula C25H37NO4
and a molecular weight of 415.57 g/mol. Its IUPAC name is propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate |
| PubChem CID | 123862098 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)CCC[C@@H]1C=C[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C25H37NO4/c1-20(2)30-25(29)15-8-3-4-9-18-26-22(13-10-14-24(26)28)16-17-23(27)19-21-11-6-5-7-12-21/h5-7,11-12,16-17,20,22-23,27H,3-4,8-10,13-15,18-19H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | SYJNCHGPSBWSBZ-DHIUTWEWSA-N |
| XLogP | 4.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate?
The IUPAC name of propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate (CID 123862098) is propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate.
What is the SMILES notation for propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate?
The canonical SMILES for propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate is CC(C)OC(=O)CCCCCCN1C(=O)CCC[C@@H]1C=C[C@@H](O)Cc1ccccc1.
What is the InChIKey of propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate?
The InChIKey is SYJNCHGPSBWSBZ-DHIUTWEWSA-N. The full InChI is InChI=1S/C25H37NO4/c1-20(2)30-25(29)15-8-3-4-9-18-26-22(13-10-14-24(26)28)16-17-23(27)19-21-11-6-5-7-12-21/h5-7,11-12,16-17,20,22-23,27H,3-4,8-10,13-15,18-19H2,1-2H3/t22-,23-/m1/s1.
What are the key properties of propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate?
propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate has a molecular weight of 415.57 g/mol, XLogP of 4.43, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 7-[(2R)-2-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]heptanoate is sourced from PubChem (CID 123862098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).