C26H33NO4S — CID 72980776
propan-2-yl 5-[3-[2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 72980776) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is propan-2-yl 5-[3-[2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 72980776 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | propan-2-yl 5-[3-[2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc(CCCN2C(=O)CCCC2C=CC(O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C26H33NO4S/c1-19(2)31-26(30)24-16-15-23(32-24)11-7-17-27-21(10-6-12-25(27)29)13-14-22(28)18-20-8-4-3-5-9-20/h3-5,8-9,13-16,19,21-22,28H,6-7,10-12,17-18H2,1-2H3 |
| InChIKey | IVFIUAJBQOHHNA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|