C22H26N2O4S — CID 67318788
5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 67318788) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 67318788 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(CCCN2C(=O)CCC[C@@H]2/C=C/[C@@H](O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H26N2O4S/c25-18(14-16-6-2-1-3-7-16)12-11-17-8-4-10-20(26)24(17)13-5-9-19-15-23-21(29-19)22(27)28/h1-3,6-7,11-12,15,17-18,25H,4-5,8-10,13-14H2,(H,27,28)/b12-11+/t17-,18-/m1/s1 |
| InChIKey | SJBNHURSZZDPKI-LLSOJIOMSA-N |
| XLogP | 3.31 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|