C21H27N3O5 — CID 87484019
5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,2,5-oxadiazole-2-carboxylic acid (PubChem CID 87484019) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,2,5-oxadiazole-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,2,5-oxadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 87484019 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propyl]-1,2,5-oxadiazole-2-carboxylic acid |
| SMILES | O=C(O)N1C=CN(CCCN2C(=O)CCC[C@@H]2/C=C/[C@@H](O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H27N3O5/c25-19(16-17-6-2-1-3-7-17)11-10-18-8-4-9-20(26)23(18)13-5-12-22-14-15-24(29-22)21(27)28/h1-3,6-7,10-11,14-15,18-19,25H,4-5,8-9,12-13,16H2,(H,27,28)/b11-10+/t18-,19-/m1/s1 |
| InChIKey | IAXGIEDYAXDGGJ-MMKWGKFASA-N |
| XLogP | 2.53 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|