C20H27NO4S2 — CID 89291005
3-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propylsulfanylmethylsulfanylformic acid (PubChem CID 89291005) has the molecular formula C20H27NO4S2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 3-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propylsulfanylmethylsulfanylformic acid.
| Compound Name | 3-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propylsulfanylmethylsulfanylformic acid |
|---|---|
| PubChem CID | 89291005 |
| Molecular Formula | C20H27NO4S2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]propylsulfanylmethylsulfanylformic acid |
| SMILES | O=C(O)SCSCCCN1C(=O)CCC[C@@H]1/C=C/C(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO4S2/c22-18(14-16-6-2-1-3-7-16)11-10-17-8-4-9-19(23)21(17)12-5-13-26-15-27-20(24)25/h1-3,6-7,10-11,17-18,22H,4-5,8-9,12-15H2,(H,24,25)/b11-10+/t17-,18?/m1/s1 |
| InChIKey | NNHKFIYWSFCQQX-VCNNCIMLSA-N |
| XLogP | 4.02 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|