C23H33NO4 — CID 141126476
ethyl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 141126476) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is ethyl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 141126476 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | ethyl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CC[C@@H]1C=C[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO4/c1-2-28-23(27)12-8-3-4-9-17-24-20(14-16-22(24)26)13-15-21(25)18-19-10-6-5-7-11-19/h5-7,10-11,13,15,20-21,25H,2-4,8-9,12,14,16-18H2,1H3/t20-,21-/m0/s1 |
| InChIKey | QYXGMQMWJJGBHQ-SFTDATJTSA-N |
| XLogP | 3.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|