C27H33NO4 — CID 91564388
7-[(2R)-2-[(3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 91564388) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 7-[(2R)-2-[(3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 91564388 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 7-[(2R)-2-[(3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CC[C@@H]1C=C[C@@H](O)Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H33NO4/c29-25(20-21-9-8-12-23(19-21)22-10-4-3-5-11-22)16-14-24-15-17-26(30)28(24)18-7-2-1-6-13-27(31)32/h3-5,8-12,14,16,19,24-25,29H,1-2,6-7,13,15,17-18,20H2,(H,31,32)/t24-,25+/m0/s1 |
| InChIKey | HNCNQOSEKBWOQU-LOSJGSFVSA-N |
| XLogP | 4.84 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|