C28H35NO5 — CID 10183380
7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylmethoxyphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 10183380) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylmethoxyphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylmethoxyphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 10183380 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylmethoxyphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CC[C@@H]1/C=C/[C@@H](O)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H35NO5/c30-25(19-23-11-8-12-26(20-23)34-21-22-9-4-3-5-10-22)16-14-24-15-17-27(31)29(24)18-7-2-1-6-13-28(32)33/h3-5,8-12,14,16,20,24-25,30H,1-2,6-7,13,15,17-19,21H2,(H,32,33)/b16-14+/t24-,25+/m0/s1 |
| InChIKey | MQNLOUUAEGSROM-YKRDXMSESA-N |
| XLogP | 4.75 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|